Wei Qiang. Exploring the stereodynamics of C(3P)+NO(X2)CO(X1+)+N(4S) reaction on 4A potential energy surfaceJ. Acta Physica Sinica, 2015, 64(17): 173401. DOI: 10.7498/aps.64.173401
|
Citation:
|
Wei Qiang. Exploring the stereodynamics of C(3P)+NO(X2)CO(X1+)+N(4S) reaction on 4A potential energy surfaceJ. Acta Physica Sinica, 2015, 64(17): 173401. DOI: 10.7498/aps.64.173401
|
Wei Qiang. Exploring the stereodynamics of C(3P)+NO(X2)CO(X1+)+N(4S) reaction on 4A potential energy surfaceJ. Acta Physica Sinica, 2015, 64(17): 173401. DOI: 10.7498/aps.64.173401
|
Citation:
|
Wei Qiang. Exploring the stereodynamics of C(3P)+NO(X2)CO(X1+)+N(4S) reaction on 4A potential energy surfaceJ. Acta Physica Sinica, 2015, 64(17): 173401. DOI: 10.7498/aps.64.173401
|